CAS 1849-73-6 appears in our catalog under these names: 7-Chlorobenzo[d]thiazole-2(3H)-thione 97%, 7-Chloro-1,3-benzothiazole-2-thiol, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
7-chloro-3H-1,3-benzothiazole-2-thione (CAS 1849-73-6) is a chemical compound with the molecular formula C7H4ClNS2 and a molecular weight of 201.7 g/mol. IUPAC name: 7-chloro-3H-1,3-benzothiazole-2-thione. InChIKey: VPDPFMGWDPYVEK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNS2 |
|---|---|
| Molecular weight | 201.7 g/mol |
| IUPAC name | 7-chloro-3H-1,3-benzothiazole-2-thione |
| InChIKey | VPDPFMGWDPYVEK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=S)N2 |
Computed by PubChem (NCBI)