Products 1849183-09-0

CAS 1849183-09-0 is the registry number for 5-Ethynyl-4-methylthiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-ethynyl-4-methylthiophene-2-carboxylic acid (CAS 1849183-09-0) is a chemical compound with the molecular formula C8H6O2S and a molecular weight of 166.20 g/mol. IUPAC name: 5-ethynyl-4-methylthiophene-2-carboxylic acid. InChIKey: LGAKZLDGWDARFC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O2S
Molecular weight166.20 g/mol
IUPAC name5-ethynyl-4-methylthiophene-2-carboxylic acid
InChIKeyLGAKZLDGWDARFC-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1)C(=O)O)C#C

Computed by PubChem (NCBI)