Products 1849280-96-1

CAS 1849280-96-1 is the registry number for 5-Ethynylthiophene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-ethynylthiophene-3-carboxylic acid (CAS 1849280-96-1) is a chemical compound with the molecular formula C7H4O2S and a molecular weight of 152.17 g/mol. IUPAC name: 5-ethynylthiophene-3-carboxylic acid. InChIKey: QBZTVCVINAUYRU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4O2S
Molecular weight152.17 g/mol
IUPAC name5-ethynylthiophene-3-carboxylic acid
InChIKeyQBZTVCVINAUYRU-UHFFFAOYSA-N
SMILESC#CC1=CC(=CS1)C(=O)O

Computed by PubChem (NCBI)