Products 1849616-53-0
CAS 1849616-53-0 appears in our catalog under these names: Decanoic acid, 2-hexyl-, 6-oxohexyl ester-1, Decanoic acid, 2-hexyl-, 6-oxohexyl ester-1, 97%, 6-Hydroxyhexyl 2-hexyldecanoate, 97%. Offered by: MedChemExpress, Ambeed, Chemat, BLDpharm. Available pack sizes: 25 mg, 250 mg, 10 mg, 50 mg, 5 mg, 1 g, 100 mg, 100mg.
6-hydroxyhexyl 2-hexyldecanoate (CAS 1849616-53-0) is a chemical compound with the molecular formula C22H44O3 and a molecular weight of 356.6 g/mol. IUPAC name: 6-hydroxyhexyl 2-hexyldecanoate. InChIKey: UXIKXWBASZQWHX-UHFFFAOYSA-N.
| Molecular formula | C22H44O3 |
|---|---|
| Molecular weight | 356.6 g/mol |
| IUPAC name | 6-hydroxyhexyl 2-hexyldecanoate |
| InChIKey | UXIKXWBASZQWHX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCO |
Computed by PubChem (NCBI)