CAS 1849616-54-1 appears in our catalog under these names: 6-Oxohexyl 2-hexyldecanoate, 98%, 6-Oxohexyl 2-hexyldecanoate, 6-Oxohexyl 2-hexyldecanoate, 80% (ELSD), 94.36%, 6-Oxohexyl 2-hexyldecanoate, 92%. Offered by: AmBeed, TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 10mg, 5mg, 100mg, 500mg, 50 mg, 100 mg.
6-oxohexyl 2-hexyldecanoate (CAS 1849616-54-1) is a chemical compound with the molecular formula C22H42O3 and a molecular weight of 354.6 g/mol. IUPAC name: 6-oxohexyl 2-hexyldecanoate. InChIKey: YUMIMGCWWZGECY-UHFFFAOYSA-N.
| Molecular formula | C22H42O3 |
|---|---|
| Molecular weight | 354.6 g/mol |
| IUPAC name | 6-oxohexyl 2-hexyldecanoate |
| InChIKey | YUMIMGCWWZGECY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCC=O |
Computed by PubChem (NCBI)