CAS 1849624-82-3 is the registry number for LI-633. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,2-a][1,4]benzodiazepine-2-carboxylic acid (CAS 1849624-82-3) is a chemical compound with the molecular formula C18H11ClFN3O2 and a molecular weight of 355.7 g/mol. IUPAC name: 8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,2-a][1,4]benzodiazepine-2-carboxylic acid. InChIKey: OMJNIBWVQQKGJT-UHFFFAOYSA-N.
| Molecular formula | C18H11ClFN3O2 |
|---|---|
| Molecular weight | 355.7 g/mol |
| IUPAC name | 8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,2-a][1,4]benzodiazepine-2-carboxylic acid |
| InChIKey | OMJNIBWVQQKGJT-UHFFFAOYSA-N |
| SMILES | C1C2=NC(=CN2C3=C(C=C(C=C3)Cl)C(=N1)C4=CC=CC=C4F)C(=O)O |
Computed by PubChem (NCBI)