CAS 1850278-18-0 is the registry number for Butoconazole Impurity 4 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-chloro-4-[4-(2,6-dichlorophenyl)sulfanylphenyl]butyl]imidazole (CAS 1850278-18-0) is a chemical compound with the molecular formula C19H17Cl3N2S and a molecular weight of 411.8 g/mol. IUPAC name: 1-[2-chloro-4-[4-(2,6-dichlorophenyl)sulfanylphenyl]butyl]imidazole. InChIKey: CQAGPTNWBGXILR-UHFFFAOYSA-N.
| Molecular formula | C19H17Cl3N2S |
|---|---|
| Molecular weight | 411.8 g/mol |
| IUPAC name | 1-[2-chloro-4-[4-(2,6-dichlorophenyl)sulfanylphenyl]butyl]imidazole |
| InChIKey | CQAGPTNWBGXILR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)SC2=CC=C(C=C2)CCC(CN3C=CN=C3)Cl)Cl |
Computed by PubChem (NCBI)