CAS 1850305-79-1 appears in our catalog under these names: 2-(Boc-Amino)ethylboronic acid pinacol ester, 97%, 2-(Boc-Amino)ethylboronic acid pinacol ester 98%, 2-(Boc-Amino)ethylboronic acid pinacol ester, 95%, 95%, tert-Butyl (2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl)carbamate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg, 100g.
Tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate (CAS 1850305-79-1) is a chemical compound with the molecular formula C13H26BNO4 and a molecular weight of 271.16 g/mol. IUPAC name: tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate. InChIKey: KXXYKDWLOOTXGS-UHFFFAOYSA-N.
| Molecular formula | C13H26BNO4 |
|---|---|
| Molecular weight | 271.16 g/mol |
| IUPAC name | tert-butyl N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]carbamate |
| InChIKey | KXXYKDWLOOTXGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)