CAS 18504-19-3 is the registry number for Bis(pentafluorophenylthio) copper(II) salt, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(2,3,4,5,6-pentafluorobenzenethiolate) (CAS 18504-19-3) is a chemical compound with the molecular formula C12CuF10S2 and a molecular weight of 461.8 g/mol. IUPAC name: copper bis(2,3,4,5,6-pentafluorobenzenethiolate). InChIKey: IITDLIATLZTNTC-UHFFFAOYSA-L.
| Molecular formula | C12CuF10S2 |
|---|---|
| Molecular weight | 461.8 g/mol |
| IUPAC name | copper bis(2,3,4,5,6-pentafluorobenzenethiolate) |
| InChIKey | IITDLIATLZTNTC-UHFFFAOYSA-L |
| SMILES | C1(=C(C(=C(C(=C1F)F)[S-])F)F)F.C1(=C(C(=C(C(=C1F)F)[S-])F)F)F.[Cu+2] |
Computed by PubChem (NCBI)