CAS 18506-04-2 appears in our catalog under these names: 5-Chloro-5H-dibenzo[a,d][7]annulene 95%, 5-Chloro-5H-Dibenzo[a,d][7]Annulene, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene (CAS 18506-04-2) is a chemical compound with the molecular formula C15H11Cl and a molecular weight of 226.70 g/mol. IUPAC name: 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene. InChIKey: XUDMFUCJNFYMRZ-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene |
| InChIKey | XUDMFUCJNFYMRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(C3=CC=CC=C3C=CC2=C1)Cl |
Computed by PubChem (NCBI)