CAS 185066-37-9 appears in our catalog under these names: Fexofenadine EP Impurity C, Fexofenadine Impurity 3(Fexofenadine EP Impurity C), Decarboxy Fexofenadine, >95% (HPLC), (1RS)-4-(4-(Hydroxydiphenylmethyl)piperidin-1-yl)-1-(4-(1-methylethyl)phenyl)butan-1-ol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 4x25mg.
4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-1-(4-propan-2-ylphenyl)butan-1-ol (CAS 185066-37-9) is a chemical compound with the molecular formula C31H39NO2 and a molecular weight of 457.6 g/mol. IUPAC name: 4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-1-(4-propan-2-ylphenyl)butan-1-ol. InChIKey: FZSQPQGERLSIOR-UHFFFAOYSA-N.
| Molecular formula | C31H39NO2 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]-1-(4-propan-2-ylphenyl)butan-1-ol |
| InChIKey | FZSQPQGERLSIOR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
Computed by PubChem (NCBI)