CAS 1851602-43-1 is the registry number for (7-Oxabicyclo(2.2.1)heptan-2-yl)methanesulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
7-oxabicyclo[2.2.1]heptan-2-ylmethanesulfonyl chloride (CAS 1851602-43-1) is a chemical compound with the molecular formula C7H11ClO3S and a molecular weight of 210.68 g/mol. IUPAC name: 7-oxabicyclo[2.2.1]heptan-2-ylmethanesulfonyl chloride. InChIKey: MTEBSNPFKJDLEU-UHFFFAOYSA-N.
| Molecular formula | C7H11ClO3S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 7-oxabicyclo[2.2.1]heptan-2-ylmethanesulfonyl chloride |
| InChIKey | MTEBSNPFKJDLEU-UHFFFAOYSA-N |
| SMILES | C1CC2C(CC1O2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)