CAS 1851650-55-9 is the registry number for 3-Nitro-5-(trifluoromethyl)pyridin-2-ol, 98+%, 98+%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3-nitro-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 1851650-55-9) is a chemical compound with the molecular formula C6H3F3N2O3 and a molecular weight of 208.09 g/mol. IUPAC name: 3-nitro-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: JYXKHKBZLLIWEV-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O3 |
|---|---|
| Molecular weight | 208.09 g/mol |
| IUPAC name | 3-nitro-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | JYXKHKBZLLIWEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)