CAS 1852-38-6 appears in our catalog under these names: Pregnenolone-3-sulfate Sodium Salt, >95% (HPLC), Pregnenolone monosulfate sodium salt, Pregnenolone sulfate (sodium salt), Pregnenolone sulfate sodium salt, 98%, 98%, Pregnenolone monosulfate (sodium), 99.96%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 25mg, 5mg, 100mg, 50mg, 10mg, 100 mg, 10 mg.
Sodium (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) sulfate (CAS 1852-38-6) is a chemical compound with the molecular formula C21H31NaO5S and a molecular weight of 418.5 g/mol. IUPAC name: sodium (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) sulfate. InChIKey: QQVJEIZJHDPTSH-UHFFFAOYSA-M.
| Molecular formula | C21H31NaO5S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | sodium (17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) sulfate |
| InChIKey | QQVJEIZJHDPTSH-UHFFFAOYSA-M |
| SMILES | CC(=O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OS(=O)(=O)[O-])C)C.[Na+] |
Computed by PubChem (NCBI)