CAS 1852-44-4 appears in our catalog under these names: Estriol Impurity 21, Estriol 16alpha-(beta-D-Glucuronide) Sodium Salt. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
CAS 1852-44-4 identifies a chemical compound with the molecular formula C24H32NaO9 and a molecular weight of 487.5 g/mol. InChIKey: OSYPVDZAIVGZEQ-UHFFFAOYSA-N.
| Molecular formula | C24H32NaO9 |
|---|---|
| Molecular weight | 487.5 g/mol |
| InChIKey | OSYPVDZAIVGZEQ-UHFFFAOYSA-N |
| SMILES | CC12CCC3C(C1CC(C2O)OC4C(C(C(C(O4)C(=O)O)O)O)O)CCC5=C3C=CC(=C5)O.[Na] |
Computed by PubChem (NCBI)