CAS 18523-44-9 is the registry number for 4-Azido-N,N-dimethylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-azido-N,N-dimethylaniline (CAS 18523-44-9) is a chemical compound with the molecular formula C8H10N4 and a molecular weight of 162.19 g/mol. IUPAC name: 4-azido-N,N-dimethylaniline. InChIKey: BKQJWJKRVJLLFK-UHFFFAOYSA-N.
| Molecular formula | C8H10N4 |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 4-azido-N,N-dimethylaniline |
| InChIKey | BKQJWJKRVJLLFK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=[N+]=[N-] |
Computed by PubChem (NCBI)