CAS 1852785-88-6 is the registry number for 2-Bromo-N1-methylbenzene-1,4-disulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-bromo-1-N-methylbenzene-1,4-disulfonamide (CAS 1852785-88-6) is a chemical compound with the molecular formula C7H9BrN2O4S2 and a molecular weight of 329.2 g/mol. IUPAC name: 2-bromo-1-N-methylbenzene-1,4-disulfonamide. InChIKey: ZKRFROKQYHPTGO-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O4S2 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 2-bromo-1-N-methylbenzene-1,4-disulfonamide |
| InChIKey | ZKRFROKQYHPTGO-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(C=C(C=C1)S(=O)(=O)N)Br |
Computed by PubChem (NCBI)