Products 18530-56-8
CAS 18530-56-8 appears in our catalog under these names: Noruron or Norea, Noruron, Noruron, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 750mg, 10mg, 1x1ml.
1,1-dimethyl-3-[(1S,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (CAS 18530-56-8) is a chemical compound with the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. IUPAC name: 1,1-dimethyl-3-[(1S,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea. InChIKey: YGLMVCVJLXREAK-MTVMDMGHSA-N.
| Molecular formula | C13H22N2O |
|---|---|
| Molecular weight | 222.33 g/mol |
| IUPAC name | 1,1-dimethyl-3-[(1S,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| InChIKey | YGLMVCVJLXREAK-MTVMDMGHSA-N |
| SMILES | CN(C)C(=O)N[C@@H]1C[C@@H]2C[C@H]1[C@H]3[C@@H]2CCC3 |
Computed by PubChem (NCBI)
Synonyms:
Noruron, NOREA, Herban, Asepta herban, Noruron [ISO], Hercules 7531, Narea, Nores, Caswell No. 607, NOREA [MI]