CAS 1853130-05-8 appears in our catalog under these names: AJS1669 free acid, AJS1669 (free acid), 99%, 99%, AJS1669 (free acid), 99.15%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 50 mg, 1 mg, 10 mg, 25 mg, 10mM/1mL.
2-[[5-[[4-(4,5-difluoro-2-methylsulfanylphenyl)phenoxy]methyl]furan-2-carbonyl]-(furan-2-ylmethyl)amino]acetic acid (CAS 1853130-05-8) is a chemical compound with the molecular formula C26H21F2NO6S and a molecular weight of 513.5 g/mol. IUPAC name: 2-[[5-[[4-(4,5-difluoro-2-methylsulfanylphenyl)phenoxy]methyl]furan-2-carbonyl]-(furan-2-ylmethyl)amino]acetic acid. InChIKey: IQZYODALPHIPRX-UHFFFAOYSA-N.
| Molecular formula | C26H21F2NO6S |
|---|---|
| Molecular weight | 513.5 g/mol |
| IUPAC name | 2-[[5-[[4-(4,5-difluoro-2-methylsulfanylphenyl)phenoxy]methyl]furan-2-carbonyl]-(furan-2-ylmethyl)amino]acetic acid |
| InChIKey | IQZYODALPHIPRX-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1C2=CC=C(C=C2)OCC3=CC=C(O3)C(=O)N(CC4=CC=CO4)CC(=O)O)F)F |
Computed by PubChem (NCBI)