CAS 1853165-96-4 is the registry number for tert-Butyl (S)-1-(3-(benzyloxy)-2-fluoropropyl)-1H-1,2,3-triazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1-[(2S)-2-fluoro-3-phenylmethoxypropyl]triazole-4-carboxylate (CAS 1853165-96-4) is a chemical compound with the molecular formula C17H22FN3O3 and a molecular weight of 335.4 g/mol. IUPAC name: tert-butyl 1-[(2S)-2-fluoro-3-phenylmethoxypropyl]triazole-4-carboxylate. InChIKey: IAFAVNRAMBWTSH-AWEZNQCLSA-N.
| Molecular formula | C17H22FN3O3 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | tert-butyl 1-[(2S)-2-fluoro-3-phenylmethoxypropyl]triazole-4-carboxylate |
| InChIKey | IAFAVNRAMBWTSH-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN(N=N1)C[C@@H](COCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)