CAS 185378-26-1 is the registry number for 3-endo-Chloro-pinane (Technical Grade). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(1S,2S,3R,5R)-3-chloro-2,6,6-trimethylbicyclo[3.1.1]heptane (CAS 185378-26-1) is a chemical compound with the molecular formula C10H17Cl and a molecular weight of 172.69 g/mol. IUPAC name: (1S,2S,3R,5R)-3-chloro-2,6,6-trimethylbicyclo[3.1.1]heptane. InChIKey: PPXZTFXSBNJCKA-UYXSQOIJSA-N.
| Molecular formula | C10H17Cl |
|---|---|
| Molecular weight | 172.69 g/mol |
| IUPAC name | (1S,2S,3R,5R)-3-chloro-2,6,6-trimethylbicyclo[3.1.1]heptane |
| InChIKey | PPXZTFXSBNJCKA-UYXSQOIJSA-N |
| SMILES | C[C@H]1[C@@H]2C[C@@H](C2(C)C)C[C@H]1Cl |
Computed by PubChem (NCBI)