Products 1854008-12-0

CAS 1854008-12-0 is the registry number for VSP-77. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[1-(4-chlorophenyl)octoxy]acetic acid (CAS 1854008-12-0) is a chemical compound with the molecular formula C16H23ClO3 and a molecular weight of 298.80 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)octoxy]acetic acid. InChIKey: AYARWYQDJCOTIK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23ClO3
Molecular weight298.80 g/mol
IUPAC name2-[1-(4-chlorophenyl)octoxy]acetic acid
InChIKeyAYARWYQDJCOTIK-UHFFFAOYSA-N
SMILESCCCCCCCC(C1=CC=C(C=C1)Cl)OCC(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3173628