CAS 1854126-41-2 appears in our catalog under these names: Chloroquine D5, Chloroquine-d5, Chloroquine-d5, 100.00%, 100.00%, Chloroquine-d5, 99.90%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-(1,1,2,2,2-pentadeuterioethyl)pentane-1,4-diamine (CAS 1854126-41-2) is a chemical compound with the molecular formula C18H26ClN3 and a molecular weight of 324.9 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-(1,1,2,2,2-pentadeuterioethyl)pentane-1,4-diamine. InChIKey: WHTVZRBIWZFKQO-SGEUAGPISA-N.
| Molecular formula | C18H26ClN3 |
|---|---|
| Molecular weight | 324.9 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)-1-N-ethyl-1-N-(1,1,2,2,2-pentadeuterioethyl)pentane-1,4-diamine |
| InChIKey | WHTVZRBIWZFKQO-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl |
Computed by PubChem (NCBI)