CAS 185416-01-7 appears in our catalog under these names: 4-Hydroxy Raloxifene, >95% (HPLC), 4-Hydroxy raloxifene, Raloxifene impurity 6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, Get quote.
[4-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (CAS 185416-01-7) is a chemical compound with the molecular formula C28H27NO4S and a molecular weight of 473.6 g/mol. IUPAC name: [4-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone. InChIKey: NOAUIPGLJUIQCW-UHFFFAOYSA-N.
| Molecular formula | C28H27NO4S |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | [4-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| InChIKey | NOAUIPGLJUIQCW-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=CC=CC(=C43)O)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)