CAS 185416-17-5 appears in our catalog under these names: 3,5–Dimethyl–4–methoxyphenylmagnesium bromide, 3,5-Dimethyl-4-methoxyphenylmagnesium bromide, 0.5M solution in THF, AcroSeal®. Offered by: GLPBio, Thermo Scientific (Acros). Available pack sizes: 100ml, 50ML.
Magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide (CAS 185416-17-5) is a chemical compound with the molecular formula C9H11BrMgO and a molecular weight of 239.39 g/mol. IUPAC name: magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide. InChIKey: XSPAONKQJCLPAB-UHFFFAOYSA-M.
| Molecular formula | C9H11BrMgO |
|---|---|
| Molecular weight | 239.39 g/mol |
| IUPAC name | magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide |
| InChIKey | XSPAONKQJCLPAB-UHFFFAOYSA-M |
| SMILES | CC1=C(C(=C[C-]=C1)C)OC.[Mg+2].[Br-] |
Computed by PubChem (NCBI)