Products 185428-18-6
CAS 185428-18-6 appears in our catalog under these names: Rivoglitazone, Rivoglitazone, 98%, 98%, Rivoglitazone, 98.59%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 5 mg, 10mM/1mL.
5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 185428-18-6) is a chemical compound with the molecular formula C20H19N3O4S and a molecular weight of 397.4 g/mol. IUPAC name: 5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: XMSXOLDPMGMWTH-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O4S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 5-[[4-[(6-methoxy-1-methylbenzimidazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | XMSXOLDPMGMWTH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)OC)N=C1COC3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)