CAS 1854496-22-2 is the registry number for 5-Bromo-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine (CAS 1854496-22-2) is a chemical compound with the molecular formula C10H13BrN2S and a molecular weight of 273.19 g/mol. IUPAC name: 5-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine. InChIKey: RHYARXSVSHBGOL-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2S |
|---|---|
| Molecular weight | 273.19 g/mol |
| IUPAC name | 5-bromo-N-(2,2-dimethylthietan-3-yl)pyridin-2-amine |
| InChIKey | RHYARXSVSHBGOL-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC2=NC=C(C=C2)Br)C |
Computed by PubChem (NCBI)