CAS 1854695-08-1 is the registry number for 3-((5-Aminothiazol-2-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine (CAS 1854695-08-1) is a chemical compound with the molecular formula C6H9N3O2S2 and a molecular weight of 219.3 g/mol. IUPAC name: 2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine. InChIKey: TTZJHZRBFFGQSU-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2S2 |
|---|---|
| Molecular weight | 219.3 g/mol |
| IUPAC name | 2-N-(1,1-dioxothietan-3-yl)-1,3-thiazole-2,5-diamine |
| InChIKey | TTZJHZRBFFGQSU-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=NC=C(S2)N |
Computed by PubChem (NCBI)