CAS 1854908-42-1 appears in our catalog under these names: Sodium 1,5-dimethyl-1H-pyrazole-4-sulfinate, 95%, Sodium 1,5-dimethyl-1H-pyrazole-4-sulfinate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Sodium 1,5-dimethylpyrazole-4-sulfinate (CAS 1854908-42-1) is a chemical compound with the molecular formula C5H7N2NaO2S and a molecular weight of 182.18 g/mol. IUPAC name: sodium 1,5-dimethylpyrazole-4-sulfinate. InChIKey: YCXJMUQHRWCOFH-UHFFFAOYSA-M.
| Molecular formula | C5H7N2NaO2S |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | sodium 1,5-dimethylpyrazole-4-sulfinate |
| InChIKey | YCXJMUQHRWCOFH-UHFFFAOYSA-M |
| SMILES | CC1=C(C=NN1C)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)