CAS 18551-03-6 is the registry number for 9-(Trimethylsilyl)-2,6-bis((trimethylsilyl)oxy)-9H-purine. Offered by: TRC. Available pack sizes: 500mg.
Trimethyl-(9-trimethylsilyl-2-trimethylsilyloxypurin-6-yl)oxysilane (CAS 18551-03-6) is a chemical compound with the molecular formula C14H28N4O2Si3 and a molecular weight of 368.65 g/mol. IUPAC name: trimethyl-(9-trimethylsilyl-2-trimethylsilyloxypurin-6-yl)oxysilane. InChIKey: XGJGXMUBMBXZQP-UHFFFAOYSA-N.
| Molecular formula | C14H28N4O2Si3 |
|---|---|
| Molecular weight | 368.65 g/mol |
| IUPAC name | trimethyl-(9-trimethylsilyl-2-trimethylsilyloxypurin-6-yl)oxysilane |
| InChIKey | XGJGXMUBMBXZQP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N1C=NC2=C1N=C(N=C2O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)