Products 185515-12-2

CAS 185515-12-2 appears in our catalog under these names: 5,6-Dihydro-4H-cyclopenta[b]thiophene-5-carboxylic acid, 97%, 97%, 5,6-Dihydro-4H-cyclopenta[b]thiophene-5-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

5,6-dihydro-4H-cyclopenta[b]thiophene-5-carboxylic acid (CAS 185515-12-2) is a chemical compound with the molecular formula C8H8O2S and a molecular weight of 168.21 g/mol. IUPAC name: 5,6-dihydro-4H-cyclopenta[b]thiophene-5-carboxylic acid. InChIKey: NLRSWIIOLVHHQE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O2S
Molecular weight168.21 g/mol
IUPAC name5,6-dihydro-4H-cyclopenta[b]thiophene-5-carboxylic acid
InChIKeyNLRSWIIOLVHHQE-UHFFFAOYSA-N
SMILESC1C(CC2=C1C=CS2)C(=O)O

Computed by PubChem (NCBI)