CAS 1855929-45-1 appears in our catalog under these names: Cypyrafluone, Huanbifucaotong, >95% (HPLC), Huanbifucaotong, Cypyrafluone, 99.58%, Cypyrafluone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, 10 mg, 5 mg, 1x10mg, 1x1ml.
1-[2-chloro-3-(5-cyclopropyl-2-methyl-3-oxo-1H-pyrazole-4-carbonyl)-6-(trifluoromethyl)phenyl]piperidin-2-one (CAS 1855929-45-1) is a chemical compound with the molecular formula C20H19ClF3N3O3 and a molecular weight of 441.8 g/mol. IUPAC name: 1-[2-chloro-3-(5-cyclopropyl-2-methyl-3-oxo-1H-pyrazole-4-carbonyl)-6-(trifluoromethyl)phenyl]piperidin-2-one. InChIKey: GDXHMHWPNWMZGI-UHFFFAOYSA-N.
| Molecular formula | C20H19ClF3N3O3 |
|---|---|
| Molecular weight | 441.8 g/mol |
| IUPAC name | 1-[2-chloro-3-(5-cyclopropyl-2-methyl-3-oxo-1H-pyrazole-4-carbonyl)-6-(trifluoromethyl)phenyl]piperidin-2-one |
| InChIKey | GDXHMHWPNWMZGI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N1)C2CC2)C(=O)C3=C(C(=C(C=C3)C(F)(F)F)N4CCCCC4=O)Cl |
Computed by PubChem (NCBI)