Products 1856080-32-4
CAS 1856080-32-4 is the registry number for Methyl 4-bromo-1-(difluoromethyl)-1H-pyrazole-5-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-bromo-1-(difluoromethyl)pyrazole-5-carboxylate (CAS 1856080-32-4) is a chemical compound with the molecular formula C6H5BrF2N2O2 and a molecular weight of 255.02 g/mol. IUPAC name: methyl 4-bromo-1-(difluoromethyl)pyrazole-5-carboxylate. InChIKey: LCLZPPAXHWKJOM-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF2N2O2 |
|---|---|
| Molecular weight | 255.02 g/mol |
| IUPAC name | methyl 4-bromo-1-(difluoromethyl)pyrazole-5-carboxylate |
| InChIKey | LCLZPPAXHWKJOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NN1C(F)F)Br |
Computed by PubChem (NCBI)