Products 185610-53-1

CAS 185610-53-1 is the registry number for O6-Diphenylcarbamoyl-N2-isobutyrylguanine. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

[2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate (CAS 185610-53-1) is a chemical compound with the molecular formula C22H20N6O3 and a molecular weight of 416.4 g/mol. IUPAC name: [2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate. InChIKey: ZFDFVLGKMZTIKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20N6O3
Molecular weight416.4 g/mol
IUPAC name[2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate
InChIKeyZFDFVLGKMZTIKZ-UHFFFAOYSA-N
SMILESCC(C)C(=O)NC1=NC2=C(C(=N1)OC(=O)N(C3=CC=CC=C3)C4=CC=CC=C4)NC=N2

Computed by PubChem (NCBI)