CAS 185610-53-1 is the registry number for O6-Diphenylcarbamoyl-N2-isobutyrylguanine. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g, 25g.
[2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate (CAS 185610-53-1) is a chemical compound with the molecular formula C22H20N6O3 and a molecular weight of 416.4 g/mol. IUPAC name: [2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate. InChIKey: ZFDFVLGKMZTIKZ-UHFFFAOYSA-N.
| Molecular formula | C22H20N6O3 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | [2-(2-methylpropanoylamino)-7H-purin-6-yl] N,N-diphenylcarbamate |
| InChIKey | ZFDFVLGKMZTIKZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=NC2=C(C(=N1)OC(=O)N(C3=CC=CC=C3)C4=CC=CC=C4)NC=N2 |
Computed by PubChem (NCBI)