CAS 1856138-98-1 is the registry number for 2-Bromo-n,6-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N,6-dimethylbenzamide (CAS 1856138-98-1) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 2-bromo-N,6-dimethylbenzamide. InChIKey: RKFIKVCLKRIPNM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 2-bromo-N,6-dimethylbenzamide |
| InChIKey | RKFIKVCLKRIPNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)C(=O)NC |
Computed by PubChem (NCBI)