Products 185614-22-6
CAS 185614-22-6 is the registry number for Phenazostatin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 6-(1-phenazin-2-yloxyethyl)phenazine-1-carboxylate (CAS 185614-22-6) is a chemical compound with the molecular formula C28H20N4O3 and a molecular weight of 460.5 g/mol. IUPAC name: methyl 6-(1-phenazin-2-yloxyethyl)phenazine-1-carboxylate. InChIKey: UMCSSUSEJCLNON-UHFFFAOYSA-N.
| Molecular formula | C28H20N4O3 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | methyl 6-(1-phenazin-2-yloxyethyl)phenazine-1-carboxylate |
| InChIKey | UMCSSUSEJCLNON-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)OC4=CC5=NC6=CC=CC=C6N=C5C=C4 |
Computed by PubChem (NCBI)