CAS 185626-66-8 appears in our catalog under these names: Haloperidol Impurity 2, Haloperidol Impurity 15, (4-(4-(4-Chlorophenyl)-4-hydroxy-1-piperidinyl)phenyl)cyclopropylmethanone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-cyclopropylmethanone (CAS 185626-66-8) is a chemical compound with the molecular formula C21H22ClNO2 and a molecular weight of 355.9 g/mol. IUPAC name: [4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-cyclopropylmethanone. InChIKey: OUDKJAWJKFIFIW-UHFFFAOYSA-N.
| Molecular formula | C21H22ClNO2 |
|---|---|
| Molecular weight | 355.9 g/mol |
| IUPAC name | [4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]phenyl]-cyclopropylmethanone |
| InChIKey | OUDKJAWJKFIFIW-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)N3CCC(CC3)(C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)