Products 1856365-78-0
CAS 1856365-78-0 is the registry number for tert-Butyl (4,6-dichloropyrimidin-5-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(4,6-dichloropyrimidin-5-yl)carbamate (CAS 1856365-78-0) is a chemical compound with the molecular formula C9H11Cl2N3O2 and a molecular weight of 264.11 g/mol. IUPAC name: tert-butyl N-(4,6-dichloropyrimidin-5-yl)carbamate. InChIKey: XKVHFBDUVDKFBV-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3O2 |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | tert-butyl N-(4,6-dichloropyrimidin-5-yl)carbamate |
| InChIKey | XKVHFBDUVDKFBV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=CN=C1Cl)Cl |
Computed by PubChem (NCBI)