Products 185674-97-9

CAS 185674-97-9 is the registry number for Mtr-S-methylisothiourea. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate (CAS 185674-97-9) is a chemical compound with the molecular formula C12H18N2O3S2 and a molecular weight of 302.4 g/mol. IUPAC name: methyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate. InChIKey: LCARMRMLFMRMAA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18N2O3S2
Molecular weight302.4 g/mol
IUPAC namemethyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate
InChIKeyLCARMRMLFMRMAA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1S(=O)(=O)N=C(N)SC)C)C)OC

Computed by PubChem (NCBI)