CAS 185674-97-9 is the registry number for Mtr-S-methylisothiourea. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Methyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate (CAS 185674-97-9) is a chemical compound with the molecular formula C12H18N2O3S2 and a molecular weight of 302.4 g/mol. IUPAC name: methyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate. InChIKey: LCARMRMLFMRMAA-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3S2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | methyl N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidothioate |
| InChIKey | LCARMRMLFMRMAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1S(=O)(=O)N=C(N)SC)C)C)OC |
Computed by PubChem (NCBI)