CAS 185674-98-0 appears in our catalog under these names: Pmc-S-methylisothiourea, Pmc–S–methylisothiourea. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 0,25g, 0,5g, 2g.
Methyl N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidothioate (CAS 185674-98-0) is a chemical compound with the molecular formula C16H24N2O3S2 and a molecular weight of 356.5 g/mol. IUPAC name: methyl N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidothioate. InChIKey: HQHUGFRYEKXPQL-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O3S2 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | methyl N'-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonyl]carbamimidothioate |
| InChIKey | HQHUGFRYEKXPQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(CC2)(C)C)C)S(=O)(=O)N=C(N)SC)C |
Computed by PubChem (NCBI)