Products 1856976-31-2
CAS 1856976-31-2 is the registry number for (5-bromo-6-chloropyridin-3-yl)(pyrrolidin-1-yl)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(5-bromo-6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone (CAS 1856976-31-2) is a chemical compound with the molecular formula C10H10BrClN2O and a molecular weight of 289.55 g/mol. IUPAC name: (5-bromo-6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone. InChIKey: QCQYCVYLDNLMJV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClN2O |
|---|---|
| Molecular weight | 289.55 g/mol |
| IUPAC name | (5-bromo-6-chloro-3-pyridinyl)-pyrrolidin-1-ylmethanone |
| InChIKey | QCQYCVYLDNLMJV-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC(=C(N=C2)Cl)Br |
Computed by PubChem (NCBI)