CAS 185699-11-0 appears in our catalog under these names: (3R,4S,5R)–2–((2–ethylhexyl)oxy)tetrahydro–2H–pyran–3,4,5–triol, 2-Ethylhexyl-D-xylopyranoside, 2-Ethylhexyl D-xylopyranoside. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 2g, 1g, 5g, 10g.
(3R,4S,5R)-2-(2-ethylhexoxy)oxane-3,4,5-triol (CAS 185699-11-0) is a chemical compound with the molecular formula C13H26O5 and a molecular weight of 262.34 g/mol. IUPAC name: (3R,4S,5R)-2-(2-ethylhexoxy)oxane-3,4,5-triol. InChIKey: ITWPYZSNVHTAGQ-VFIJVLHUSA-N.
| Molecular formula | C13H26O5 |
|---|---|
| Molecular weight | 262.34 g/mol |
| IUPAC name | (3R,4S,5R)-2-(2-ethylhexoxy)oxane-3,4,5-triol |
| InChIKey | ITWPYZSNVHTAGQ-VFIJVLHUSA-N |
| SMILES | CCCCC(CC)COC1[C@@H]([C@H]([C@@H](CO1)O)O)O |
Computed by PubChem (NCBI)