Products 1857348-85-6
CAS 1857348-85-6 is the registry number for 2-(2-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile (CAS 1857348-85-6) is a chemical compound with the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. IUPAC name: 2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile. InChIKey: CVBWNNYHAPCNEE-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO2 |
|---|---|
| Molecular weight | 257.14 g/mol |
| IUPAC name | 2-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetonitrile |
| InChIKey | CVBWNNYHAPCNEE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)CC#N |
Computed by PubChem (NCBI)