CAS 919119-59-8 appears in our catalog under these names: 2-Methyl-1H-indole-7-boronic acid pinacol ester, 95%, 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole 98%, 2-Methyl-1H-indole-7-boronic acid pinacol ester, 98%, 98%, 2-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g.
2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 919119-59-8) is a chemical compound with the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. IUPAC name: 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: JLLLSNSEZXGVMY-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO2 |
|---|---|
| Molecular weight | 257.14 g/mol |
| IUPAC name | 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | JLLLSNSEZXGVMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(N3)C |
Computed by PubChem (NCBI)