Products 1858191-70-4
CAS 1858191-70-4 is the registry number for 2-Chloro-2′-deoxy-N,N-dimethyladenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-[2-chloro-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (CAS 1858191-70-4) is a chemical compound with the molecular formula C12H16ClN5O3 and a molecular weight of 313.74 g/mol. IUPAC name: (2R,3S,5R)-5-[2-chloro-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol. InChIKey: OJPQERRUJFRXHV-XLPZGREQSA-N.
| Molecular formula | C12H16ClN5O3 |
|---|---|
| Molecular weight | 313.74 g/mol |
| IUPAC name | (2R,3S,5R)-5-[2-chloro-6-(dimethylamino)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | OJPQERRUJFRXHV-XLPZGREQSA-N |
| SMILES | CN(C)C1=NC(=NC2=C1N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O)Cl |
Computed by PubChem (NCBI)