Products 1858206-76-4
CAS 1858206-76-4 appears in our catalog under these names: BTK inhibitor 17, BTK inhibitor 17/ 99.57% (existing batch purity), BTK inhibitor 17, 99.53%, BTK inhibitor 17. Offered by: GLPBio, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg.
4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrazolo[4,5-d]pyridazin-7-one (CAS 1858206-76-4) is a chemical compound with the molecular formula C25H24N6O3 and a molecular weight of 456.5 g/mol. IUPAC name: 4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrazolo[4,5-d]pyridazin-7-one. InChIKey: QUYXPVXTKPTPCA-QGZVFWFLSA-N.
| Molecular formula | C25H24N6O3 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | 4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-6H-pyrazolo[4,5-d]pyridazin-7-one |
| InChIKey | QUYXPVXTKPTPCA-QGZVFWFLSA-N |
| SMILES | C=CC(=O)N1CCC[C@H](C1)N2C3=C(C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)C(=NNC3=O)N |
Computed by PubChem (NCBI)