CAS 1858240-96-6 is the registry number for (4-Nitrophenyl)(2-oxo-1,3-oxazolidin-4-yl)methyl methanesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[(4-nitrophenyl)-(2-oxo-1,3-oxazolidin-4-yl)methyl] methanesulfonate (CAS 1858240-96-6) is a chemical compound with the molecular formula C11H12N2O7S and a molecular weight of 316.29 g/mol. IUPAC name: [(4-nitrophenyl)-(2-oxo-1,3-oxazolidin-4-yl)methyl] methanesulfonate. InChIKey: KXQMITSNQQNKDW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O7S |
|---|---|
| Molecular weight | 316.29 g/mol |
| IUPAC name | [(4-nitrophenyl)-(2-oxo-1,3-oxazolidin-4-yl)methyl] methanesulfonate |
| InChIKey | KXQMITSNQQNKDW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC(C1COC(=O)N1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)