CAS 1858242-40-6 is the registry number for N,N-Dimethyl-6-piperidin-4-ylpyridine-2-carboxamide dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N,N-dimethyl-6-piperidin-4-ylpyridine-2-carboxamide;dihydrochloride (CAS 1858242-40-6) is a chemical compound with the molecular formula C13H21Cl2N3O and a molecular weight of 306.23 g/mol. IUPAC name: N,N-dimethyl-6-piperidin-4-ylpyridine-2-carboxamide;dihydrochloride. InChIKey: HRIVWJHKINNLJH-UHFFFAOYSA-N.
| Molecular formula | C13H21Cl2N3O |
|---|---|
| Molecular weight | 306.23 g/mol |
| IUPAC name | N,N-dimethyl-6-piperidin-4-ylpyridine-2-carboxamide;dihydrochloride |
| InChIKey | HRIVWJHKINNLJH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=N1)C2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)