Products 1858250-20-0

CAS 1858250-20-0 is the registry number for N,N-Dimethyl-6-(piperidin-3-ylmethyl)pyridazin-3-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

N,N-dimethyl-6-(piperidin-3-ylmethyl)pyridazin-3-amine (CAS 1858250-20-0) is a chemical compound with the molecular formula C12H20N4 and a molecular weight of 220.31 g/mol. IUPAC name: N,N-dimethyl-6-(piperidin-3-ylmethyl)pyridazin-3-amine. InChIKey: PAJIQEFTVGFOHB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N4
Molecular weight220.31 g/mol
IUPAC nameN,N-dimethyl-6-(piperidin-3-ylmethyl)pyridazin-3-amine
InChIKeyPAJIQEFTVGFOHB-UHFFFAOYSA-N
SMILESCN(C)C1=NN=C(C=C1)CC2CCCNC2

Computed by PubChem (NCBI)