CAS 1858250-37-9 is the registry number for 4-Bromo-1,5-diphenyl-1h-1,2,3-triazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-bromo-1,5-diphenyltriazole (CAS 1858250-37-9) is a chemical compound with the molecular formula C14H10BrN3 and a molecular weight of 300.15 g/mol. IUPAC name: 4-bromo-1,5-diphenyltriazole. InChIKey: DHJLIYMHBZORMQ-UHFFFAOYSA-N.
| Molecular formula | C14H10BrN3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | 4-bromo-1,5-diphenyltriazole |
| InChIKey | DHJLIYMHBZORMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=NN2C3=CC=CC=C3)Br |
Computed by PubChem (NCBI)